| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:47 UTC |
|---|
| Update Date | 2025-03-25 00:53:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200789 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16O5 |
|---|
| Molecular Mass | 312.0998 |
|---|
| SMILES | COc1ccc2oc(-c3ccc(OC)c(OC)c3)cc(=O)c2c1 |
|---|
| InChI Key | QYDMYMLHNGOWLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 6-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 3'-o-methylated flavonoids4'-o-methylated flavonoidsalkyl aryl ethersanisoleschromonesdimethoxybenzenesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran6-methoxyflavonoid-skeletonalkyl aryl etherdimethoxybenzeneorganic oxidechromonearomatic heteropolycyclic compoundo-dimethoxybenzenepyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compoundmethoxybenzene3p-methoxyflavonoid-skeletonoxacycleorganic oxygen compoundpyrananisole4p-methoxyflavonoid-skeletonhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|