| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:47 UTC |
|---|
| Update Date | 2025-03-25 00:53:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200801 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H26O9 |
|---|
| Molecular Mass | 446.1577 |
|---|
| SMILES | COc1ccc2c(CCC(=O)O)c(CCC(=O)O)c(CCCC(=O)O)c(CC(=O)O)c2c1 |
|---|
| InChI Key | GOMIESWWBQIFNK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acidshydrocarbon derivativesnaphthalenesorganic oxides |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidaromatic homopolycyclic compoundtetracarboxylic acid or derivativesalkyl aryl etherorganic oxidenaphthaleneorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganooxygen compound |
|---|