| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:48 UTC |
|---|
| Update Date | 2025-03-25 00:53:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200814 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11FO3 |
|---|
| Molecular Mass | 270.0692 |
|---|
| SMILES | COc1ccc2c(=O)cc(-c3ccc(F)cc3)oc2c1 |
|---|
| InChI Key | FQRUARKLFVTIIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 7-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl fluorideschromonesflavonoidsfluorobenzenesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganofluoridesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | aryl fluoridephenol ethermonocyclic benzene moietyether1-benzopyranalkyl aryl etherorganohalogen compoundfluorobenzeneorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranorganofluorideheteroaromatic compoundaryl halideoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoid7-methoxyflavonoid-skeletonhalobenzeneorganooxygen compound |
|---|