| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:48 UTC |
|---|
| Update Date | 2025-03-25 00:53:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200817 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO3 |
|---|
| Molecular Mass | 285.1365 |
|---|
| SMILES | COc1ccc2c(c1)C(C)C(O)C(c1ccc(O)cc1)N2 |
|---|
| InChI Key | SKFQWHQQJIIZMH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativeshydroquinolinesorganopnictogen compoundssecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherphenylquinoline1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtetrahydroquinolinealcoholazacyclesecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundanisolesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
