| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:49 UTC |
|---|
| Update Date | 2025-03-25 00:53:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200855 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H25N3O2 |
|---|
| Molecular Mass | 303.1947 |
|---|
| SMILES | COc1ccc2[nH]cc(CCN3CCN(CCO)CC3)c2c1 |
|---|
| InChI Key | PRSWVOYAAPRJGA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalcohols and polyolsalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesn-alkylpiperazinesorganopnictogen compoundspyrrolestrialkylamines |
|---|
| Substituents | phenol etheretherindolealkyl aryl etherpiperazinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary aminealkanolaminealcoholazacycle1,2-aminoalcoholn-alkylpiperazineheteroaromatic compoundtertiary aliphatic amineorganic oxygen compoundanisole1,4-diazinanepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
