| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:50 UTC |
|---|
| Update Date | 2025-03-25 00:53:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200904 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H27NO2 |
|---|
| Molecular Mass | 301.2042 |
|---|
| SMILES | COc1ccc2c(c1)C13CCCC(OC)C1C(C2)N(C)CC3 |
|---|
| InChI Key | MTWIHOBGZAJTEF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsbenzazocinesdialkyl ethershydrocarbon derivativesorganopnictogen compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etherdialkyl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundphenanthreneazacycletertiary aliphatic amineorganic oxygen compoundanisolebenzazocinehydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|