| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:50 UTC |
|---|
| Update Date | 2025-03-25 00:53:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200909 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17NO |
|---|
| Molecular Mass | 239.131 |
|---|
| SMILES | COc1ccc2c(c1)N(C)C(c1ccccc1)C2 |
|---|
| InChI Key | LFFGYVMLQRDVJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaralkylaminesazacyclic compoundsbenzene and substituted derivativesdialkylarylamineshydrocarbon derivativesorganopnictogen compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherazacycleindolealkyl aryl etheraralkylamineorganic oxygen compoundaromatic heteropolycyclic compoundanisoletertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compounddialkylarylamineaminetertiary amineorganooxygen compound |
|---|