| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:51 UTC |
|---|
| Update Date | 2025-03-25 00:53:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200952 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO12 |
|---|
| Molecular Mass | 419.1064 |
|---|
| SMILES | COc1cc(CC(N)C(=O)O)c(O)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1O |
|---|
| InChI Key | GXCNOWLPPGDPNT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4-alkoxyphenolsacetalsalkyl aryl ethersalpha amino acidsanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmethoxybenzenesmethoxylated amphetaminesmethoxyphenolsmonoalkylaminesmonosaccharideso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundsphenylalanine and derivativesphenylpropanoic acidspyran carboxylic acidsresorcinolssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidmethoxyphenolo-glucuronidemonosaccharidepyran carboxylic acidresorcinol1-o-glucuronidebeta-hydroxy acidsaccharideacetalorganonitrogen compoundalpha-amino acidoxaneorganoheterocyclic compoundalcoholtyrosine or derivativesmethoxylated amphetaminemethoxybenzeneanisoledicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminephenoxy compoundcarbonyl groupetherglucuronic acid or derivativesaromatic heteromonocyclic compound3-phenylpropanoic-acidalkyl aryl etherorganic oxideorganopnictogen compoundamphetamine or derivatives4-alkoxyphenolpyran carboxylic acid or derivativeshydroxy acidoxacyclephenylalanine or derivativesorganic oxygen compoundpyransecondary alcoholbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|