| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:53 UTC |
|---|
| Update Date | 2025-03-25 00:53:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201025 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28O11 |
|---|
| Molecular Mass | 492.1632 |
|---|
| SMILES | COc1cc(CCC(=O)CC(O)c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2)ccc1O |
|---|
| InChI Key | UJPCKXIGOYOJKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | gingerols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsalkyl aryl ethersalkyl glycosidesanisolesaromatic alcoholsbeta hydroxy acids and derivativesbeta-hydroxy ketonescarboxylic acidsfatty acyl glycosides of mono- and disaccharidesfatty alcoholsglucuronic acid derivativeshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | aromatic alcoholfatty acylbeta-hydroxy ketonefatty acyl glycoside of mono- or disaccharidephenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalfatty alcoholoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesfatty acyl glycosidehydroxy acidmethoxybenzeneoxacyclegingerolmonocarboxylic acid or derivativesorganic oxygen compoundpyrananisolesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compoundalkyl glycoside |
|---|
