| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:53 UTC |
|---|
| Update Date | 2025-03-25 00:53:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201042 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11BrO6 |
|---|
| Molecular Mass | 377.9739 |
|---|
| SMILES | COc1cc(-c2oc3cc(O)c(Br)cc3c(=O)c2O)ccc1O |
|---|
| InChI Key | CBYMDDYUYZMMND-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3'-o-methylated flavonoids3-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisolesaryl bromideschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolso-bromophenolsorganic oxidesorganobromidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganohalogen compoundorganic oxidechromonearomatic heteropolycyclic compoundpyranone2-bromophenolorganoheterocyclic compoundbenzopyranheteroaromatic compoundmethoxybenzene3p-methoxyflavonoid-skeletonaryl halideoxacycleorganic oxygen compoundpyrananisole7-hydroxyflavonoidorganobromide4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundaryl bromideorganooxygen compound |
|---|
