| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:54 UTC |
|---|
| Update Date | 2025-03-25 00:53:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201062 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O3 |
|---|
| Molecular Mass | 198.1256 |
|---|
| SMILES | C=CC1(C)CCCC(C)(C(=O)OC)O1 |
|---|
| InChI Key | QXPCUZAOQLOTDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsdialkyl ethershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acids |
|---|
| Substituents | c-glucuronidecarbonyl groupetherpyran carboxylic acid or derivativescarboxylic acid derivativepyran carboxylic aciddialkyl etheroxacycleorganic oxidemonocarboxylic acid or derivativesmethyl esterpyrancarboxylic acid esteraliphatic heteromonocyclic compoundhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|
