| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:57 UTC |
|---|
| Update Date | 2025-03-25 00:53:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201204 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N4O5 |
|---|
| Molecular Mass | 358.1277 |
|---|
| SMILES | COc1ccc(-n2cnc3c(ncn3C3CC(O)C(CO)O3)c2=O)cc1 |
|---|
| InChI Key | DHYYGFIZAPFJFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine 2'-deoxyribonucleosides |
|---|
| Direct Parent | purine 2'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmethoxybenzenesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherlactammonosaccharidepyrimidoneimidazopyrimidinealkyl aryl etherpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholpurine 2'-deoxyribonucleosideorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundanisolesecondary alcoholhypoxanthinehydrocarbon derivativebenzenoidpurineorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
