| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:57 UTC |
|---|
| Update Date | 2025-03-25 00:53:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201205 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O3 |
|---|
| Molecular Mass | 256.1099 |
|---|
| SMILES | COc1ccc(C(=Cc2ccc(O)cc2)CO)cc1 |
|---|
| InChI Key | VVFFTQWIXXZHOW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalcohols and polyolsalkyl aryl ethersanisolescinnamyl alcoholshydrocarbon derivativesmethoxybenzenesphenoxy compounds |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidcinnamyl alcoholalkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundstilbene |
|---|