| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:59 UTC |
|---|
| Update Date | 2025-03-25 00:53:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201271 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H26N2O2 |
|---|
| Molecular Mass | 374.1994 |
|---|
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)CC(c3cccnc3)N(C)C2)cc1 |
|---|
| InChI Key | DQPWHFGORRLZBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkaloids and derivativesalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethylpyridinesn-alkylpyrrolidinesorganopnictogen compoundsphenoxy compoundsphenylpyrrolidinespyrrolespyrrolidinylpyridinestrialkylamines |
|---|
| Substituents | diphenylmethanephenol etheretheraromatic heteromonocyclic compoundpyrrolidinylpyridinealkyl aryl etheraralkylamineorganonitrogen compoundorganopnictogen compoundpyrrolidinetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidineheteroaromatic compoundtertiary aliphatic aminemethylpyridinemethoxybenzene3-phenylpyrrolidinealkaloid or derivativespyridineorganic oxygen compoundanisolepyrrolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
