| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:00 UTC |
|---|
| Update Date | 2025-03-25 00:53:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201294 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24N2O4 |
|---|
| Molecular Mass | 320.1736 |
|---|
| SMILES | COc1ccc(C2CC(=O)N(CCN(C)C)C(=O)C2)cc1OC |
|---|
| InChI Key | QCGPFRWZBOFKOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamsdicarboximidesdimethoxybenzeneshydrocarbon derivativesn-substituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsphenoxy compoundspiperidinedionestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxideo-dimethoxybenzeneorganonitrogen compoundorganopnictogen compoundpiperidinedionepiperidinonedicarboximidecarboxylic acid imide, n-substitutedtertiary amineazacycletertiary aliphatic aminemethoxybenzenecarboxylic acid imidedelta-lactamorganic oxygen compoundphenylpiperidineanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
