| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:00 UTC |
|---|
| Update Date | 2025-03-25 00:53:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201306 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H32N2O6 |
|---|
| Molecular Mass | 468.226 |
|---|
| SMILES | COc1ccc(C2C(OC(C)=O)C(=O)N(CCN3CCOCC3)C2c2ccc(OC)cc2)cc1 |
|---|
| InChI Key | OOZLCGSMKLMKGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acid estersdialkyl ethershydrocarbon derivativeslactamsmethoxybenzenesmonocarboxylic acids and derivativesmorpholinesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsphenylpyrrolidinespyrrolespyrrolidine-2-onestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | 2-pyrrolidonephenol ethermonocyclic benzene moietycarbonyl groupetherlactamaromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativedialkyl etherorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidonetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidine2-phenylpyrrolidinetertiary aliphatic aminecarboxamide groupmethoxybenzeneoxazinaneoxacycle3-phenylpyrrolidinemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compoundstilbene |
|---|
