| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:00 UTC |
|---|
| Update Date | 2025-03-25 00:53:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201309 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H25NO2 |
|---|
| Molecular Mass | 335.1885 |
|---|
| SMILES | COc1ccc(C(CCN(C)C)c2cc(O)c3ccccc3c2)cc1 |
|---|
| InChI Key | MHYZXWWAKRQTPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesorganopnictogen compoundsphenoxy compoundstrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethertertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidalkyl aryl ethermethoxybenzeneorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-naphtholorganic nitrogen compoundphenoxy compoundaminetertiary amineorganooxygen compound |
|---|
