| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:01 UTC |
|---|
| Update Date | 2025-03-25 00:53:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201327 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O3 |
|---|
| Molecular Mass | 270.1256 |
|---|
| SMILES | COc1ccc(C(CC(=O)O)c2ccc(C)cc2)cc1 |
|---|
| InChI Key | KOYLNMIEDVXCEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic monoterpenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenoxy compoundsphenylpropanoic acidstoluenes |
|---|
| Substituents | diphenylmethanemonoterpenoidphenol ethercarbonyl groupmonocyclic monoterpenoidethercarboxylic acid3-phenylpropanoic-acidp-cymenealkyl aryl ethercarboxylic acid derivativeorganic oxidemethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolehydrocarbon derivativephenoxy compoundtolueneorganooxygen compoundaromatic monoterpenoid |
|---|
