| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:02 UTC |
|---|
| Update Date | 2025-03-25 00:53:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201348 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O10 |
|---|
| Molecular Mass | 346.09 |
|---|
| SMILES | COc1cc(O)c(C(=O)OCC2OC(O)C(O)C(O)C2O)c(O)c1 |
|---|
| InChI Key | BVJMKWWZRWMXCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoyl derivativescarboxylic acid estershemiacetalshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundsresorcinolssalicylic acid and derivativessecondary alcoholsvinylogous acidso-hydroxybenzoic acid esters |
|---|
| Substituents | phenol etheretheraromatic heteromonocyclic compoundmethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidebenzoate esteralkyl aryl ethercarboxylic acid derivativeresorcinolsaccharideorganic oxidehemiacetaloxaneorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidmethoxybenzeneoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid esterp-methoxybenzoic acid or derivativesanisolecarboxylic acid estersecondary alcoholphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
