| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:10 UTC |
|---|
| Update Date | 2025-03-25 00:53:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201636 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H5Cl3O3S |
|---|
| Molecular Mass | 273.9025 |
|---|
| SMILES | Cc1c(Cl)cc(S(=O)(=O)O)c(Cl)c1Cl |
|---|
| InChI Key | UOGYSDTVPMCUTR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonic acids and derivatives |
|---|
| Direct Parent | p-methylbenzenesulfonates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsaryl chloridesarylsulfonic acids and derivativesbenzenesulfonyl compoundschlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganosulfonic acidssulfonylstoluenes |
|---|
| Substituents | aryl chloridechlorobenzeneorganosulfonic acid or derivatives1-sulfo,2-unsubstituted aromatic compoundorganochlorideorganosulfonic acidorganosulfur compoundorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativeshydrocarbon derivativehalobenzenep-methylbenzenesulfonatetoluenebenzenesulfonyl group |
|---|