| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:10 UTC |
|---|
| Update Date | 2025-03-25 00:53:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201647 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O5 |
|---|
| Molecular Mass | 224.0685 |
|---|
| SMILES | Cc1c(O)cc(O)c(CC(=O)C(=O)O)c1C |
|---|
| InChI Key | KBFFVOFOFZPOEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidshydrocarbon derivativesmeta cresolsmonocarboxylic acids and derivativesorganic oxidesortho cresolspara cresolsphenylpropanoic acidsresorcinolso-xylenes |
|---|
| Substituents | carbonyl groupcarboxylic acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoidalpha-hydroxy ketonecarboxylic acid derivativeresorcinolketonexyleneorganic oxidep-cresolo-cresolalpha-keto acidm-cresolphenylpyruvatearomatic homomonocyclic compoundmonocarboxylic acid or derivativeso-xyleneorganic oxygen compoundketo acidphenolhydrocarbon derivativeorganooxygen compound |
|---|