| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:13 UTC |
|---|
| Update Date | 2025-03-25 00:53:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201756 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17NO2 |
|---|
| Molecular Mass | 267.1259 |
|---|
| SMILES | Cc1ccc(C(=O)N2Cc3ccccc3C(O)C2)cc1 |
|---|
| InChI Key | WYAKVYDSGYESNI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesn,n-dialkyl-p-toluamidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholstertiary carboxylic acid amidestetrahydroisoquinolines |
|---|
| Substituents | monocyclic benzene moietybenzoylcarboxylic acid derivativetoluamidebenzamideorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundalcoholazacyclebenzoic acid or derivativescarboxamide groupbenzylisoquinolinep-toluamideorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidn,n-dialkyl-p-toluamideorganic nitrogen compoundtolueneorganooxygen compound |
|---|
