| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:14 UTC |
|---|
| Update Date | 2025-03-25 00:53:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201802 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H26O3 |
|---|
| Molecular Mass | 290.1882 |
|---|
| SMILES | Cc1ccc(CC2OC(C(=O)O)C(C)C(C)C2C)cc1C |
|---|
| InChI Key | HDEJUJUDVDBCBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidso-xylenes |
|---|
| Substituents | c-glucuronidemonocyclic benzene moietycarbonyl groupethercarboxylic acidpyran carboxylic acid or derivativesaromatic heteromonocyclic compoundcarboxylic acid derivativepyran carboxylic aciddialkyl etherxyleneoxacycleorganic oxidemonocarboxylic acid or derivativeso-xylenepyranhydrocarbon derivativebenzenoidoxaneorganoheterocyclic compound |
|---|
