| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:16 UTC |
|---|
| Update Date | 2025-03-25 00:53:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201875 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14O4 |
|---|
| Molecular Mass | 246.0892 |
|---|
| SMILES | Cc1cc(OCC(O)C(=O)O)c2ccccc2c1 |
|---|
| InChI Key | QQHPGUOFCFQLTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesphenol etherssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholphenol ethercarbonyl groupethercarboxylic acidalpha-hydroxy acidmonosaccharidearomatic homopolycyclic compoundhydroxy acidalkyl aryl ethercarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundglyceric_acidsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|