| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:18 UTC |
|---|
| Update Date | 2025-03-25 00:53:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02201927 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O7 |
|---|
| Molecular Mass | 302.1114 |
|---|
| SMILES | COC1C(O)C(CO)OC(n2cc(C)c(=O)[nH]c2=O)C1O |
|---|
| InChI Key | CSSYUSVPYZJFTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholsvinylogous amides |
|---|
| Substituents | etherlactamaromatic heteromonocyclic compoundmonosaccharidepyrimidonedialkyl ethersaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
