| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:21 UTC |
|---|
| Update Date | 2025-03-25 00:53:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202053 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H13NO5S2 |
|---|
| Molecular Mass | 231.0235 |
|---|
| SMILES | CS(=O)(=O)CCCCNS(=O)(=O)O |
|---|
| InChI Key | YGOFVTWFNMPJEE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid monoamides |
|---|
| Direct Parent | sulfuric acid monoamides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfones |
|---|
| Substituents | aliphatic acyclic compoundorganosulfur compoundorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundsulfone |
|---|