| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:21 UTC |
|---|
| Update Date | 2025-03-25 00:53:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202069 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7S |
|---|
| Molecular Mass | 348.0304 |
|---|
| SMILES | CS(=O)(=O)Oc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
|---|
| InChI Key | LVOKLTVZWMHYKP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids7-hydroxyflavonoidschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethanesulfonatesorganic oxidesorganooxygen compoundsorganosulfonic acid estersoxacyclic compoundsphenoxy compoundspyranones and derivativessulfonic acid esterssulfonylsvinylogous acids |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundsulfonic acid esterorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidorganosulfonic acid estermethanesulfonateoxacyclevinylogous acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativespyran7-hydroxyflavonoidhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
