| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:23 UTC |
|---|
| Update Date | 2025-03-25 00:53:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202133 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H10N2O4S3 |
|---|
| Molecular Mass | 245.9803 |
|---|
| SMILES | CS(=O)SCCC(N)=NS(=O)(=O)O |
|---|
| InChI Key | LYFDTQKJKIWEGQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amidineshydrocarbon derivativesorganic oxidesorganopnictogen compoundssulfenyl compoundssulfinyl compoundsthiosulfinic acid esters |
|---|
| Substituents | aliphatic acyclic compoundorganic sulfuric acid or derivativessulfenyl compoundamidineorganosulfur compoundorganic oxidethiosulfinic acid esterorganic oxygen compoundsulfinyl compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
