| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:24 UTC |
|---|
| Update Date | 2025-03-25 00:53:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202160 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9NO4S |
|---|
| Molecular Mass | 215.0252 |
|---|
| SMILES | CS(=O)(=O)c1ccc(O)c(C(N)=O)c1 |
|---|
| InChI Key | RUBHGMDKSPUFSZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amidessulfonesvinylogous acids |
|---|
| Substituents | primary carboxylic acid amidebenzoyl1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl groupcarboxamide groupsalicylamidearomatic homomonocyclic compoundvinylogous acidsulfonylorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundsulfone |
|---|
