| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:26 UTC |
|---|
| Update Date | 2025-03-25 00:53:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202234 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H22N2O5P+ |
|---|
| Molecular Mass | 257.1261 |
|---|
| SMILES | C[N+](C)(C)CC(O)COP(=O)(O)OCCN |
|---|
| InChI Key | BWUIHMUUSSOYGM-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminescholinesdialkyl phosphateshydrocarbon derivativesmonoalkylaminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | alcoholaliphatic acyclic compoundtetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltdialkyl phosphatephosphoethanolamineorganic oxideorganic oxygen compoundcholineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic cationorganic saltaminealkyl phosphateorganooxygen compound |
|---|
