| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:28 UTC |
|---|
| Update Date | 2025-03-25 00:53:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202338 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N2O+ |
|---|
| Molecular Mass | 219.1492 |
|---|
| SMILES | C[N+]1(Cc2ccc(C(N)=O)cc2)CCCC1 |
|---|
| InChI Key | SWERCCZLWPWYPZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundsbenzoyl derivativesbenzylaminescarboxylic acids and derivativeshydrocarbon derivativesn-alkylpyrrolidinesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundsphenylmethylaminesprimary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundbenzoylcarboxylic acid derivativearalkylaminebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltpyrrolidineorganoheterocyclic compoundtetraalkylammonium saltazacyclen-alkylpyrrolidinequaternary ammonium saltcarboxamide groupphenylmethylamineorganic oxygen compoundbenzylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
