| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:29 UTC |
|---|
| Update Date | 2025-03-25 00:53:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202354 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24FN5O6S2 |
|---|
| Molecular Mass | 477.1152 |
|---|
| SMILES | CSCCNc1nc(SCCC(F)C(=O)O)nc2c1ncn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | RVPSIGVXTZDPKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylarylthioethersalpha-halocarboxylic acidsamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersfatty acylshalogenated fatty acidsheteroaromatic compoundshydrocarbon derivativeshydroxy fatty acidsimidazolesimidolactamsmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganofluoridesorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary alkylarylaminessulfenyl compoundstetrahydrofuransthia fatty acids |
|---|
| Substituents | alpha-halocarboxylic acid or derivativescarboxylic acidamino acid or derivativesmonosaccharideimidazopyrimidinealpha-halocarboxylic acidaryl thioethersaccharideorganonitrogen compoundhydroxy fatty acidorganoheterocyclic compoundalcoholsulfenyl compoundazacyclealkyl fluoridedialkylthioetherpurine nucleosideheteroaromatic compoundsecondary aliphatic/aromatic aminethioetherhydrocarbon derivativeaminefatty acylcarbonyl groupamino acidalkylarylthioetherorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundalkyl halideprimary alcoholimidolactamazolen-substituted imidazolehalogenated fatty acidtetrahydrofuranorganofluoridesecondary amineoxacyclemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundsecondary alcoholpurineorganic nitrogen compoundorganooxygen compound |
|---|