| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:31 UTC |
|---|
| Update Date | 2025-03-25 00:53:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202411 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N2O+ |
|---|
| Molecular Mass | 181.1335 |
|---|
| SMILES | C[N+](C)(C)C(O)c1ccc(N)cc1 |
|---|
| InChI Key | OPMMVHZTEXBDJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkanolaminesaromatic alcoholshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundsprimary aminestetraalkylammonium salts |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietytetraalkylammonium saltaromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compoundalkanolamine |
|---|
