| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:31 UTC |
|---|
| Update Date | 2025-03-25 00:53:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5OS |
|---|
| Molecular Mass | 237.0684 |
|---|
| SMILES | CSc1cnc2[nH]c(N(C)C)nc(=O)c2n1 |
|---|
| InChI Key | XBXOOEJIOHXYEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersaminopyrimidines and derivativesazacyclic compoundsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidonessulfenyl compoundsvinylogous amides |
|---|
| Substituents | pyrimidonealkylarylthioetherorganosulfur compoundaryl thioetherpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddialkylarylaminevinylogous amidepterinsulfenyl compoundazacycleheteroaromatic compoundaminopyrimidineorganic oxygen compoundthioetherpyrazinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
