| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:32 UTC |
|---|
| Update Date | 2025-03-25 00:53:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202449 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15ClNO+ |
|---|
| Molecular Mass | 212.0837 |
|---|
| SMILES | C[N+](C)(C)C(C(=O)Cl)c1ccccc1 |
|---|
| InChI Key | FWXFXIMIRGQYHG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acyl chloridesaralkylaminesbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganochloridesorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouptetraalkylammonium saltorganochloridequaternary ammonium saltorganohalogen compoundacyl halidearalkylaminearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundacyl chlorideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|