| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:33 UTC |
|---|
| Update Date | 2025-03-25 00:53:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202509 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O5 |
|---|
| Molecular Mass | 258.0528 |
|---|
| SMILES | O=C(O)c1ccc(O)c(OC(=O)c2ccccc2)c1 |
|---|
| InChI Key | RVCONMPQCWHHDQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoic acid estersbenzoic acidsbenzoyl derivativescarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxybenzoic acid derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesbenzoate estercarboxylic acid derivativehydroxybenzoic acidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterphenol esterdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidbenzoic acidphenoxy compoundorganooxygen compounddepside backbone |
|---|
