| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:35 UTC |
|---|
| Update Date | 2025-03-25 00:53:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202555 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O9 |
|---|
| Molecular Mass | 344.1107 |
|---|
| SMILES | O=C(OC1C(O)C(O)C(O)C(O)C1O)C(CO)c1cccc(O)c1 |
|---|
| InChI Key | XOYCWNLFZIZYAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcyclohexanol1-hydroxy-2-unsubstituted benzenoidcyclitol or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidcyclic alcoholcarboxylic acid derivativearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterphenolhydrocarbon derivativebenzenoidprimary alcohol |
|---|