| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:38 UTC |
|---|
| Update Date | 2025-03-25 00:53:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202687 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO5 |
|---|
| Molecular Mass | 243.1107 |
|---|
| SMILES | O=C(O)CNC(CC1C=CC(O)CC1)C(=O)O |
|---|
| InChI Key | JGXZKAOSQLNFHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidscarbonyl compoundscarboxylic acidsdialkylaminesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholsecondary aliphatic aminecarbonyl groupcarboxylic acidamino acidsecondary amineorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino acidsecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|