| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:40 UTC |
|---|
| Update Date | 2025-03-25 00:53:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202757 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O5 |
|---|
| Molecular Mass | 272.0685 |
|---|
| SMILES | O=C(O)Cc1ccc(O)c(C(=O)c2ccc(O)cc2)c1 |
|---|
| InChI Key | QOXBDXRMQICJCO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidaryl-phenylketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
