| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:40 UTC |
|---|
| Update Date | 2025-03-25 00:53:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202778 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7NO5 |
|---|
| Molecular Mass | 221.0324 |
|---|
| SMILES | O=C(O)c1c(NCc2ccco2)c(=O)c1=O |
|---|
| InChI Key | MRVRSSVUZLUWOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acids |
|---|
| Direct Parent | 1-carboxy-2-haloaromatic compounds |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidscyclic ketonesfuransheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | furanvinylogous amidearomatic heteromonocyclic compoundamino acid or derivativesamino acidheteroaromatic compoundcyclic ketonesecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundorganic nitrogen compoundamineorganoheterocyclic compoundorganooxygen compound |
|---|
