| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:41 UTC |
|---|
| Update Date | 2025-03-25 00:53:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O6 |
|---|
| Molecular Mass | 252.0634 |
|---|
| SMILES | O=C(O)COc1ccc(CC(=O)CC(=O)O)cc1 |
|---|
| InChI Key | KJQDCSDGQGWRLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesphenol ethersphenoxy compounds |
|---|
| Substituents | beta-hydroxy ketonephenol etherphenoxyacetatecarbonyl groupethercarboxylic acidalkyl aryl ethercarboxylic acid derivativebeta-keto acidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundketo aciddicarboxylic acid or derivativeshydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|