| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:42 UTC |
|---|
| Update Date | 2025-03-25 00:53:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202825 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7FO4 |
|---|
| Molecular Mass | 198.0328 |
|---|
| SMILES | O=C(O)Cc1cc(F)cc(C(=O)O)c1 |
|---|
| InChI Key | KUSRHBBPGYWAEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | 3-halobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridesbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfluorobenzeneshalobenzoic acidshydrocarbon derivativesorganic oxidesorganofluorides |
|---|
| Substituents | aryl fluoridecarbonyl groupcarboxylic acidbenzoylcarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxide3-halobenzoic acidbenzoic acidhalobenzoic acidorganofluoridearyl halidearomatic homomonocyclic compoundorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativehalobenzeneorganooxygen compound |
|---|