| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:42 UTC |
|---|
| Update Date | 2025-03-25 00:53:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202847 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11Cl2NO |
|---|
| Molecular Mass | 291.0218 |
|---|
| SMILES | O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ncccc21 |
|---|
| InChI Key | BZWPAELISUUTCI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl alkyl ketonesaryl chloridesazacyclic compoundsdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivatives |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonephenylquinolinepolyhalopyridineorganochlorideorganohalogen compoundketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzene2-halopyridinearyl chloridechlorobenzeneazacycleheteroaromatic compoundaryl halidepyridineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compoundaryl ketone |
|---|
