| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:43 UTC |
|---|
| Update Date | 2025-03-25 00:53:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202881 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O7 |
|---|
| Molecular Mass | 370.1053 |
|---|
| SMILES | O=C1CCC(Cc2cc(O)c3c(c2)OC(O)C(c2ccc(O)cc2)C3=O)O1 |
|---|
| InChI Key | MZJIWOBNDILEMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-hydroxyisoflavanonesaryl alkyl ketonesbenzene and substituted derivativescarboxylic acid esterschromonesgamma butyrolactoneshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofuransvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl group2-hydroxyisoflavanonearyl alkyl ketone1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeisoflavanoneketonelactoneorganic oxidechromonearomatic heteropolycyclic compoundchromanehemiacetalorganoheterocyclic compoundbenzopyrantetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|