| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:45 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202929 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H32N2O3 |
|---|
| Molecular Mass | 456.2413 |
|---|
| SMILES | O=C1Nc2ccccc2C1(O)CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | HYFGCWYWJCMUPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesindolesindolineslactamsorganic oxidesorganopnictogen compoundspiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl grouplactamamino acid or derivativesindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddihydroindolepiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic amineindole or derivativescarboxamide groupsecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
