| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202964 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H4O8P2 |
|---|
| Molecular Mass | 217.9381 |
|---|
| SMILES | O=C1COP(=O)(OP(=O)(O)O)O1 |
|---|
| InChI Key | BTUQMHRPGATWPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organic oxoanionic compounds |
|---|
| Subclass | organic pyrophosphates |
|---|
| Direct Parent | organic pyrophosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsdioxaphospholaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compounds |
|---|
| Substituents | carbonyl group1,3_dioxaphospholanecarboxylic acid derivativeorganic pyrophosphateoxacycleorganic oxidemonocarboxylic acid or derivativesaliphatic heteromonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
