| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202972 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6ClNO2S |
|---|
| Molecular Mass | 238.9808 |
|---|
| SMILES | O=C1NC(=O)C(=Cc2ccccc2Cl)S1 |
|---|
| InChI Key | LODOBCLAGUEESL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | thiazolidines |
|---|
| Direct Parent | thiazolidinediones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsthiazolidinesthiolactones |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundorganochloridecarboxylic acid derivativeorganohalogen compoundthiazolidinedioneorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximidethiolactonearyl chloridechlorobenzenecarbonic acid derivativeazacyclearyl halideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
