| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202973 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11NO4 |
|---|
| Molecular Mass | 233.0688 |
|---|
| SMILES | O=C1NC(=O)C2C1COC2c1ccc(O)cc1 |
|---|
| InChI Key | SNNMVUWMXXACQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdicarboximideshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrrolidine-2-onestetrahydrofurans |
|---|
| Substituents | 2-pyrrolidonemonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl ethercarboxylic acid imide, n-unsubstitutedorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidepyrrolidinepyrrolidoneorganoheterocyclic compoundazacycletetrahydrofurancarboxylic acid imideoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
