| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02202985 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O3 |
|---|
| Molecular Mass | 238.063 |
|---|
| SMILES | O=C1C(c2ccc(O)cc2)=Cc2cc(O)ccc21 |
|---|
| InChI Key | PRWNBVZXOBJURR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundketoneorganic oxideindeneorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
