| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:48 UTC |
|---|
| Update Date | 2025-03-25 00:53:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203042 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7NO6S |
|---|
| Molecular Mass | 244.9994 |
|---|
| SMILES | O=C1C(O)Oc2ccccc2N1S(=O)(=O)O |
|---|
| InChI Key | IGNMUTGPSQJHME-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxazines |
|---|
| Subclass | benzoxazinones |
|---|
| Direct Parent | benzoxazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsbenzomorpholinescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | carbonyl grouporganic sulfuric acid or derivativesazacyclecarboxylic acid derivativebenzomorpholineoxazinaneoxacyclemorpholineorganic oxidebenzoxazinoneorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
